Search

Article

x

留言板

姓名
邮箱
手机号码
标题
留言内容
验证码

Citation:

GUO Changmin, ZHANG Hong, CHENG Xinlu
cstr: 32037.14.aps.74.20250533
Article Text (iFLYTEK Translation)
PDF
HTML
Get Citation
  • The scattering cross-sections and reaction rate coefficients are crucial parameters for elucidating the energy transfer mechanism of state-to-state collisions between molecular gases and also serve as a fundamental basis for modeling the non-equilibrium flow field. However, the database of kinetic processes related to nitrogen shock flows is still being developed. In this work, a detailed kinetic study of the N2 + O2 collision is carried out by combining the quasi-classical trajectory method (QCT) and neural network model (NN). Firstly, QCT is used to calculate 90 N2(v) + O2(w) processes with various initial vibrational states (v,w), and the contributions of all vibrational excitation and dissociation reaction channels are discussed. The following conclusions are drawn: 1) The contributions of the vibration-vibration (VV) energy exchange channel of O2 and N2 are similar, while the vibration-translational (VT) transition mainly occurs on O2; 2) The total dissociation cross-section primarily results from the O2 single-dissociation channel, followed by the exchange-dissociation channel, with relatively minor contributions from the N2 single- and double-dissociation channels. Then, based on the QCT dataset, a high-performance NN model (R-value of 0.99) is trained to predict the total dissociation cross-section caused by N2(v) + O2(w) collisions. Compared with the method that only uses QCT, the method that jointly uses OCT and NN model can achieve an approximately 91.94% reduction in computational cost. Finally, to facilitate use in kinetic modeling, Arrhenius-type fits for the VV/VT rate coefficients are provided over the temperature range of 5000–30000 K, and an exponential form related to the translational energy Et is used to fit the total dissociation cross-section.
      Corresponding author: CHENG Xinlu, chengxl@scu.edu.cn
    • Funds: Project supported by the National Key R&D Program of China (Grant No. 2024YFF0508503).
    [1]

    [2]

    [3]

    [4]

    [5]

    [6]

    [7]

    [8]

    [9]

    [10]

    [11]

    [12]

    [13]

    [14]

    [15]

    [16]

    [17]

    [18]

    [19]

    [20]

    [21]

    [22]

    [23]

    [24]

    [25]

    [26]

    [27]

    [28]

    [29]

    [30]

    [31]

    [32]

    [33]

    [34]

    [35]

    [36]

    [37]

    [38]

    [39]

    [40]

    [41]

    [42]

    [43]

  • Group N2(v) O2(w) Et (eV)
    1 {0, 5, 10, 21, 30} {0, 1, 3, 7, 10, 15, 21, 25, 30} {0.2, 0.6, 1, 2,
    3, 4, 5, 6, 7, 8, 9, 10}
    2 {0, 1, 3, 7, 10, 15, 21, 25, 30, 35} {0, 5, 10, 21, 30}
    DownLoad: CSV

    N2(v) + O2(w) → N2(v') + O2(w') A n B MSE
    (0, 10) → (1, 9) 4.10 × 10–10 –2.91 × 10–1 4.81 × 104 4.27 × 10–26
    (0, 10) → (0, 9) 2.44 × 10–10 4.28 × 10–2 2.01 × 104 7.67 × 10–22
    (0, 10) → (0, 8) 3.33 × 10–10 –6.70 × 10–2 3.10 × 104 3.04 × 10–23
    (0, 10) → (0, 7) 3.95 × 10–10 –1.39 × 10–1 3.96 × 104 2.66 × 10–24
    (0, 21) → (1, 20) 4.24 × 10–10 –4.58 × 10–1 –4.53 × 103 4.21 × 10–23
    (0, 21) → (0, 20) 3.50 × 10–10 2.04 × 10–1 2.78 × 103 7.96 × 10–21
    (0, 21) → (0, 19) 2.51 × 10–10 –3.01 × 10–2 1.94 × 104 2.32 × 10–22
    (0, 21) → (0, 18) 2.87 × 10–10 –7.43 × 10–2 2.46 × 104 5.62 × 10–23
    (0, 30) → (1, 29) 3.01 × 10–10 –3.75 × 10–1 4.79 × 104 6.99 × 10–27
    (0, 30) → (0, 29) 1.39 × 10–10 9.46 × 10–2 7.06 × 103 6.44 × 10–21
    (0, 30) → (0, 28) 1.49 × 10–10 2.78 × 10–3 9.00 × 103 9.18 × 10–22
    (0, 30) → (0, 27) 1.74 × 10–10 –5.01 × 10–2 1.14 × 104 2.99 × 10–22
    (15, 10) → (16, 9) 2.31 × 10–10 –9.11 × 10–2 1.73 × 104 8.85 × 10–23
    (15, 10) → (17, 8) 3.46 × 10–10 –2.77 × 10–1 3.64 × 104 2.77 × 10–25
    (15, 10) → (18, 7) 3.94 × 10–10 –3.69 × 10–1 4.36 × 104 1.97 × 10–26
    (15, 10) → (15, 9) 1.97 × 10–10 5.51 × 10–3 1.30 × 104 8.14 × 10–22
    (15, 10) → (15, 8) 2.78 × 10–10 –1.96 × 10–1 2.58 × 104 4.40 × 10–24
    (15, 10) → (15, 7) 3.17 × 10–10 –3.04 × 10–1 3.38 × 104 2.16 × 10–25
    (15, 21) → (16, 20) 1.79 × 10–10 –2.61 × 10–2 1.56 × 104 2.42 × 10–22
    (15, 21) → (17, 19) 2.69 × 10–10 –3.02 × 10–1 2.64 × 104 5.21 × 10–25
    (15, 21) → (18, 18) 3.12 × 10–10 –3.82 × 10–1 3.60 × 104 3.42 × 10–26
    (15, 21) → (15, 20) 1.96 × 10–10 7.64 × 10–2 1.35 × 104 2.82 × 10–21
    (15, 21) → (15, 19) 2.46 × 10–10 –1.03 × 10–1 2.19 × 104 3.80 × 10–23
    (15, 21) → (15, 18) 2.07 × 10–10 –1.88 × 10–1 2.49 × 104 3.33 × 10–24
    (15, 30) → (16, 29) 9.24 × 10–11 –8.39 × 10–2 1.39 × 103 3.39 × 10–22
    (15, 30) → (17, 28) 2.05 × 10–10 –3.47 × 10–1 2.70 × 104 1.23 × 10–25
    (15, 30) → (18, 27) 3.20 × 10–10 –4.66 × 10–1 3.90 × 104 4.67 × 10–27
    (15, 30) → (15, 29) 1.17 × 10–10 1.13 × 10–1 4.53 × 103 1.04 × 10–20
    (15, 30) → (15, 28) 1.57 × 10–10 –1.67 × 10–2 1.10 × 104 5.05 × 10–22
    (15, 30) → (15, 27) 5.12 × 10–10 –2.19 × 10–1 1.17 × 104 1.06 × 10–22
    (35, 10) → (36, 9) 5.68 × 10–10 –5.32 × 10–2 3.17 × 103 1.51 × 10–20
    (35, 10) → (37, 8) 1.30 × 10–9 –2.97 × 10–1 6.01 × 103 4.83 × 10–22
    (35, 10) → (38, 7) 4.10 × 10–10 –3.94 × 10–1 6.35 × 103 7.64 × 10–24
    (35, 10) → (35, 9) 2.01 × 10–10 –6.83 × 10–2 1.58 × 104 1.33 × 10–22
    (35, 10) → (35, 8) 1.98 × 10–10 –2.33 × 10–1 1.85 × 104 3.73 × 10–24
    (35, 10) → (35, 7) 1.88 × 10–10 –3.31 × 10–1 2.17 × 104 3.19 × 10–25
    (35, 21) → (36, 20) 1.79 × 10–10 –2.60 × 10–2 1.56 × 104 2.42 × 10–22
    (35, 21) → (37, 19) 2.69 × 10–10 –3.02 × 10–1 2.64 × 104 5.21 × 10–25
    (35, 21) → (38, 18) 3.12 × 10–10 –3.82 × 10–1 3.60 × 104 3.4 × 10–26
    (35, 21) → (35, 20) 1.96 × 10–10 7.64 × 10–2 1.35 × 104 2.82 × 10–21
    (35, 21) → (35, 19) 2.46 × 10–10 –1.03 × 10–1 2.19 × 104 3.80 × 10–23
    (35, 21) → (35, 18) 2.07 × 10–10 –1.88 × 10–1 2.49 × 104 3.33 × 10–24
    (35, 30) → (36, 29) 5.99 × 10–10 –8.87 × 10–2 1.96 × 103 1.15 × 10–20
    (35, 30) → (37, 28) 4.54 × 10–10 –2.35 × 10–1 3.14 × 103 3.48 × 10–22
    (35, 30) → (38, 27) 9.69 × 10–11 –2.38 × 10–1 5.53 × 103 9.00 × 10–24
    (35, 30) → (35, 29) 6.49 × 10–11 1.25 × 10–1 3.21 × 103 5.24 × 10–21
    (35, 30) → (35, 28) 1.25 × 10–10 –9.18 × 10–2 1.26 × 104 6.00 × 10–23
    (35, 30) → (35, 27) 1.61 × 10–10 –2.35 × 10–1 1.59 × 104 3.84 × 10–24
    DownLoad: CSV

    N2(v) O2(w) a b c RMSE
    0 1 1.98 × 101 –1.02 × 102 9.03 × 100 1.82 × 10–4
    0 3 1.13 × 101 –5.82 × 101 5.11 × 100 3.54 × 10–4
    0 5 8.29 × 100 –4.30 × 101 3.87 × 100 2.95 × 10–3
    0 7 6.43 × 100 –3.35 × 101 3.14 × 100 8.48 × 10–3
    0 10 –2.46 × 102 3.52 × 101 –9.70 × 10–1 5.70 × 10–3
    0 15 –9.18 × 101 1.06 × 101 2.57 × 10–1 8.02 × 10–3
    0 21 –2.04 × 101 2.24 × 10–1 8.60 × 10–1 3.37 × 10–2
    0 25 –5.67 × 100 –1.11 × 100 1.01 × 100 6.37 × 10–2
    0 30 –6.06 × 10–1 –5.62 × 10–1 1.10 × 100 1.30 × 10–1
    1 21 –2.03 × 101 3.57 × 10–1 8.50 × 10–1 2.33 × 10–2
    1 30 –7.54 × 10–1 –4.60 × 10–1 1.09 × 100 1.58 × 10–1
    3 15 –7.75 × 101 8.74 × 100 3.16 × 10–1 1.44 × 10–2
    3 21 –2.10 × 101 1.02 × 100 7.94 × 10–1 4.72 × 10–2
    3 30 –8.40 × 10–1 –3.81 × 10–1 1.09 × 100 1.73 × 10–1
    5 30 –8.07 × 10–1 –3.74 × 10–1 1.09 × 100 1.94 × 10–1
    5 0 8.27 × 100 –4.28 × 101 3.65 × 100 6.98 × 10–3
    5 1 8.21 × 100 –4.25 × 101 3.75 × 100 3.78 × 10–3
    5 3 7.21 × 100 –3.75 × 101 3.44 × 100 6.53 × 10–3
    5 7 –3.96 × 102 6.61 × 101 –2.62 × 100 1.60 × 10–3
    5 10 –2.83 × 102 4.83 × 101 –1.81 × 100 5.40 × 10–3
    5 15 –7.95 × 101 9.94 × 100 2.43 × 10–1 2.80 × 10–2
    5 21 –1.95 × 101 8.26 × 10–1 8.08 × 10–1 3.42 × 10–2
    5 25 –6.46 × 100 –4.60 × 10–1 9.66 × 10–1 6.22 × 10–2
    7 15 –6.79 × 101 8.41 × 100 2.93 × 10–1 2.57 × 10–2
    7 21 –1.85 × 101 6.82 × 10–1 8.22 × 10–1 3.75 × 10–2
    7 30 –7.52 × 101 –3.87 × 10–1 1.09 × 100 2.02 × 10–1
    10 15 –6.21 × 101 7.99 × 100 3.14 × 10–1 3.16 × 10–2
    10 21 –1.75 × 101 7.87 × 10–1 8.16 × 10–1 4.21 × 10–2
    10 30 –6.64 × 10–1 –4.20 × 10–1 1.09 × 100 2.00 × 10–1
    15 0 3.92 × 100 –2.04 × 101 2.03 × 100 1.68 × 10–2
    15 3 3.21 × 100 –1.68 × 101 1.83 × 100 4.68 × 10–2
    15 7 –1.97 × 102 3.56 × 101 –1.29 × 100 2.32 × 10–2
    15 10 –1.12 × 102 1.78 × 101 –2.20 × 10–1 3.96 × 10–2
    15 15 –4.74 × 101 5.30 × 100 5.20 × 10–1 3.20 × 10–2
    15 21 –1.20 × 101 –4.00 × 10–1 9.19 × 10–1 5.88 × 10–2
    15 25 –5.0 × 100 –5.65 × 10–1 9.88 × 10–1 3.51 × 10–2
    15 30 –6.92 × 10–1 –3.97 × 10–1 1.09 × 100 1.50 × 10–1
    18 21 –1.16 × 101 –2.55 × 10–1 9.34 × 10–1 5.33 × 10–2
    21 15 –3.44 × 101 4.04 × 100 6.22 × 10–1 4.97 × 10–2
    21 0 –7.70 × 101 5.01 × 100 5.89 × 10–1 1.06 × 10–2
    21 1 –7.61 × 101 5.57 × 100 5.54 × 10–1 7.48 × 10–3
    21 3 –8.50 × 101 9.82 × 100 2.65 × 10–1 1.68 × 10–2
    21 7 –6.54 × 101 7.75 × 100 3.69 × 10–1 2.71 × 10–2
    21 10 –4.66 × 101 4.61 × 100 5.73 × 10–1 1.65 × 10–2
    21 18 –1.81 × 101 8.87 × 10–1 8.42 × 10–1 6.70 × 10–2
    21 21 –1.09 × 101 8.07 × 10–2 9.19 × 10–1 5.56 × 10–2
    21 25 –3.91 × 100 –8.38 × 10–1 1.04 × 100 6.94 × 10–2
    21 27 –2.07 × 100 –7.80 × 10–1 1.07 × 100 6.97 × 10–2
    21 30 –4.61 × 10–1 –5.58 × 10–1 1.12 × 100 1.79 × 10–1
    27 21 –6.79 × 100 –4.70 × 10–1 1.02 × 100 8.37 × 10–2
    30 15 –9.22 × 100 –3.68 × 10–1 9.65 × 10–1 1.25 × 10–1
    30 21 –4.34 × 100 –9.02 × 10–1 1.08 × 100 1.40 × 10–1
    30 30 1.01 × 10–1 –8.90 × 10–1 1.23 × 100 3.85 × 10–1
    35 21 –2.49 × 100 –8.65 × 10–1 1.13 × 100 1.79 × 10–1
    35 5 –1.15 × 101 5.75 × 10–1 8.62 × 10–1 5.73 × 10–2
    35 10 –8.09 × 100 –4.55 × 10–2 9.44 × 10–1 7.15 × 10–2
    35 30 1.06 × 10–1 –8.47 × 10–1 1.29 × 100 5.14 × 10–1
    DownLoad: CSV
  • [1]

    [2]

    [3]

    [4]

    [5]

    [6]

    [7]

    [8]

    [9]

    [10]

    [11]

    [12]

    [13]

    [14]

    [15]

    [16]

    [17]

    [18]

    [19]

    [20]

    [21]

    [22]

    [23]

    [24]

    [25]

    [26]

    [27]

    [28]

    [29]

    [30]

    [31]

    [32]

    [33]

    [34]

    [35]

    [36]

    [37]

    [38]

    [39]

    [40]

    [41]

    [42]

    [43]

  • [1] TAN Xu, FANG Fan, ZHANG Yu, SUN Dehao, WU Yijiao, YIN Hao, MENG Tianming, TU Bingsheng, WEI Baoren. Dissociation of fluoromethane trication induced by highly charged ion collisions. Acta Physica Sinica, 2025, 74(21): 213401. doi: 10.7498/aps.74.20251099
    [2] Zhou Yong. Quantum dynamics study of C—H stretching vibrational excitation in the F+CHD3 → HF+CD3 reaction. Acta Physica Sinica, 2024, 73(9): 098201. doi: 10.7498/aps.73.20231832
    [3] Yang Ying, Cao Huai-Xin. Two types of neural network representations of quantum mixed states. Acta Physica Sinica, 2023, 72(11): 110301. doi: 10.7498/aps.72.20221905
    [4] Wei Qiang. Exploring the stereodynamics of C(3P)+NO(X2)CO(X1+)+N(4S) reaction on 4A potential energy surface. Acta Physica Sinica, 2015, 64(17): 173401. doi: 10.7498/aps.64.173401
    [5] Hu Mei, Liu Xin-Guo, Tan Rui-Shan. Influence of collision energy and reagent vibrational excitation on the stereodynamics of reaction Ar+H2+→ArH++H. Acta Physica Sinica, 2014, 63(2): 023402. doi: 10.7498/aps.63.023402
    [6] Qu Ding-Rong, Fan Feng-Ying, Song Zeng-Yun. Quenching rate of laser-excited lithium atoms with argon molecules in photochemical reaction. Acta Physica Sinica, 2014, 63(3): 032801. doi: 10.7498/aps.63.032801
    [7] Wang Xiao-Lian, Feng Hao, Sun Wei-Guo, Fan Qun-Chao, Wang Bin, Zeng Yang-Yang. Momentum transfer cross sections of low-energy electron scattering from H2 molecule with the polarization potential using the distributed spherical Gaussian model. Acta Physica Sinica, 2011, 60(2): 023401. doi: 10.7498/aps.60.023401
    [8] Wang Wei, Jiang Gang. Study on rate coefficient of dielectronic recombination in dense plasma based on doubly excited state. Acta Physica Sinica, 2010, 59(11): 7815-7823. doi: 10.7498/aps.59.7815
    [9] Wang Xiao-Lian, Feng Hao, Sun Wei-Guo, Fan Qun-Chao, Zeng Yang-Yang, Wang Bin. Momentum transfer cross sections of low-energy electron scattering from H2 molecule. Acta Physica Sinica, 2010, 59(2): 937-942. doi: 10.7498/aps.59.937
    [10] Shen Guang-Xian, Wang Rong-Kai, Linghu Rong-Feng, Yang Xiang-Dong. Theoretical study on the partial cross section for the second vibrational excitation in He-H2 collisions. Acta Physica Sinica, 2009, 58(6): 3827-3832. doi: 10.7498/aps.58.3827
    [11] Wang Bin, Feng Hao, Sun Wei-Guo, Zeng Yang-Yang, Dai Wei. Vibrational excitation integrated cross sections of e-H2 scattering. Acta Physica Sinica, 2009, 58(10): 6932-6937. doi: 10.7498/aps.58.6932
    [12] Dai Wei, Feng Hao, Sun Wei-Guo, Tang Yong-Jian, Shen Li, Yu Jiang-Zhou. Studies on vibrational excitation differential cross sections of low-energy electron scattering from N2 molecule by vibrational close-coupling method. Acta Physica Sinica, 2008, 57(1): 143-148. doi: 10.7498/aps.57.143
    [13] Yu Jiang-Zhou, Feng Hao, Sun Wei-Guo. Studies on the momentum transfer cross sections for low-energy electron scattering by nitrogen molecule. Acta Physica Sinica, 2008, 57(7): 4143-4147. doi: 10.7498/aps.57.4143
    [14] Yu A-Long. Research on the amplitude frequency characteristics compensation based on wavelet neural network for vibration velocity transducer. Acta Physica Sinica, 2007, 56(6): 3166-3171. doi: 10.7498/aps.56.3166
    [15] Zheng Dun-Sheng, Guo Xi-Kun. Dissociation of the HCN molecule in the highly excited vibrational states. Acta Physica Sinica, 2004, 53(10): 3347-3352. doi: 10.7498/aps.53.3347
    [16] Tan Wen, Wang Yao-Nan, Zhou Shao-Wu, Liu Zu-Run. Prediction of the chaotic time series using neuro-fuzzy networks. Acta Physica Sinica, 2003, 52(4): 795-801. doi: 10.7498/aps.52.795
    [17] WANG HONG-XIA, YU JUE-BANG. ANALYSIS OF STABILITY FOR EQUILIBRIUM OFCELLULAR NEURAL NETWORKS. Acta Physica Sinica, 2001, 50(12): 2303-2306. doi: 10.7498/aps.50.2303
    [18] FANG QUAN-YU, CAI WEI, ZOU YU, LI PING. A GENERALIZED BETHE ANALYTIC FORMULA: DIPOLE-EXCITED COLLISION STRENGTHS AND CORRESPONDING RATE COEFFICIENTS IN Au50+. Acta Physica Sinica, 1998, 47(10): 1612-1620. doi: 10.7498/aps.47.1612
    [19] FANG QUAN-YU, CAI WEI, SHEN ZHI-JUN, ZOU YU, LI PING, XU YUAN-GUANG. COLLISION STRENGTHS AND RATE COEFFICIENTS OF Li-LIKE IONS BY ELECTRON IMPACT. Acta Physica Sinica, 1996, 45(10): 1641-1646. doi: 10.7498/aps.45.1641
    [20] NI GUANG-JIONG. THE PAIRING VIBRATION MODEL OF MESON STATES. Acta Physica Sinica, 1976, 25(4): 336-339. doi: 10.7498/aps.25.336
Metrics
  • Abstract views:  1623
  • PDF Downloads:  53
  • Cited By: 0
Publishing process
  • Received Date:  23 April 2025
  • Accepted Date:  23 May 2025
  • Available Online:  06 June 2025
  • Published Online:  05 August 2025
    返回文章
    返回